C19H20N6O6S — CID 10004422
8-amino-1,3-bis(cyclopropylmethyl)-7-(4-nitrophenyl)sulfonylpurine-2,6-dione (PubChem CID 10004422) has the molecular formula C19H20N6O6S and a molecular weight of 460.47 g/mol. Its IUPAC name is 8-amino-1,3-bis(cyclopropylmethyl)-7-(4-nitrophenyl)sulfonylpurine-2,6-dione.
| Compound Name | 8-amino-1,3-bis(cyclopropylmethyl)-7-(4-nitrophenyl)sulfonylpurine-2,6-dione |
|---|---|
| PubChem CID | 10004422 |
| Molecular Formula | C19H20N6O6S |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 8-amino-1,3-bis(cyclopropylmethyl)-7-(4-nitrophenyl)sulfonylpurine-2,6-dione |
| SMILES | Nc1nc2c(c(=O)n(CC3CC3)c(=O)n2CC2CC2)n1S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H20N6O6S/c20-18-21-16-15(24(18)32(30,31)14-7-5-13(6-8-14)25(28)29)17(26)23(10-12-3-4-12)19(27)22(16)9-11-1-2-11/h5-8,11-12H,1-4,9-10H2,(H2,20,21) |
| InChIKey | YAZXYHMZIMSXGE-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 165.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|