C20H24F3NO4S2 — CID 10004602
4-[2-[(4S)-4-[(E,3S)-3-hydroxy-4-[3-(trifluoromethyl)phenyl]but-1-enyl]-2-oxo-1,3-thiazolidin-3-yl]ethylsulfanyl]butanoic acid (PubChem CID 10004602) has the molecular formula C20H24F3NO4S2 and a molecular weight of 463.54 g/mol. Its IUPAC name is 4-[2-[(4S)-4-[(E,3S)-3-hydroxy-4-[3-(trifluoromethyl)phenyl]but-1-enyl]-2-oxo-1,3-thiazolidin-3-yl]ethylsulfanyl]butanoic acid.
| Compound Name | 4-[2-[(4S)-4-[(E,3S)-3-hydroxy-4-[3-(trifluoromethyl)phenyl]but-1-enyl]-2-oxo-1,3-thiazolidin-3-yl]ethylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 10004602 |
| Molecular Formula | C20H24F3NO4S2 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 4-[2-[(4S)-4-[(E,3S)-3-hydroxy-4-[3-(trifluoromethyl)phenyl]but-1-enyl]-2-oxo-1,3-thiazolidin-3-yl]ethylsulfanyl]butanoic acid |
| SMILES | O=C(O)CCCSCCN1C(=O)SC[C@@H]1/C=C/[C@@H](O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H24F3NO4S2/c21-20(22,23)15-4-1-3-14(11-15)12-17(25)7-6-16-13-30-19(28)24(16)8-10-29-9-2-5-18(26)27/h1,3-4,6-7,11,16-17,25H,2,5,8-10,12-13H2,(H,26,27)/b7-6+/t16-,17+/m0/s1 |
| InChIKey | ILMFKXVUHOLDBJ-YMPXZSTISA-N |
| XLogP | 4.30 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|