C26H46N2O5 — CID 10004756
(2R,4S,5S,7S)-5-amino-N-butyl-4-hydroxy-7-[[3-(3-hydroxypropoxy)-4-methoxyphenyl]methyl]-2,8-dimethylnonanamide (PubChem CID 10004756) has the molecular formula C26H46N2O5 and a molecular weight of 466.66 g/mol. Its IUPAC name is (2R,4S,5S,7S)-5-amino-N-butyl-4-hydroxy-7-[[3-(3-hydroxypropoxy)-4-methoxyphenyl]methyl]-2,8-dimethylnonanamide.
| Compound Name | (2R,4S,5S,7S)-5-amino-N-butyl-4-hydroxy-7-[[3-(3-hydroxypropoxy)-4-methoxyphenyl]methyl]-2,8-dimethylnonanamide |
|---|---|
| PubChem CID | 10004756 |
| Molecular Formula | C26H46N2O5 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.34 |
| IUPAC Name | (2R,4S,5S,7S)-5-amino-N-butyl-4-hydroxy-7-[[3-(3-hydroxypropoxy)-4-methoxyphenyl]methyl]-2,8-dimethylnonanamide |
| SMILES | CCCCNC(=O)[C@H](C)C[C@H](O)[C@@H](N)C[C@H](Cc1ccc(OC)c(OCCCO)c1)C(C)C |
| InChI | InChI=1S/C26H46N2O5/c1-6-7-11-28-26(31)19(4)14-23(30)22(27)17-21(18(2)3)15-20-9-10-24(32-5)25(16-20)33-13-8-12-29/h9-10,16,18-19,21-23,29-30H,6-8,11-15,17,27H2,1-5H3,(H,28,31)/t19-,21+,22+,23+/m1/s1 |
| InChIKey | MOFNHEDQVLWLOH-SWUCNREESA-N |
| XLogP | 3.29 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|