C22H24F3NO5S — CID 10004965
N-hydroxy-4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 10004965) has the molecular formula C22H24F3NO5S and a molecular weight of 471.50 g/mol. Its IUPAC name is N-hydroxy-4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 10004965 |
| Molecular Formula | C22H24F3NO5S |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | N-hydroxy-4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)c2ccc(-c3ccc(CCCC(F)(F)F)cc3)cc2)CCOCC1 |
| InChI | InChI=1S/C22H24F3NO5S/c23-22(24,25)11-1-2-16-3-5-17(6-4-16)18-7-9-19(10-8-18)32(29,30)21(20(27)26-28)12-14-31-15-13-21/h3-10,28H,1-2,11-15H2,(H,26,27) |
| InChIKey | SJHFVGORQZDOFQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|