C29H32N2O2S — CID 10005032
N-[[4-[(naphthalen-2-ylmethylamino)methyl]cyclohexyl]methyl]naphthalene-2-sulfonamide (PubChem CID 10005032) has the molecular formula C29H32N2O2S and a molecular weight of 472.65 g/mol. Its IUPAC name is N-[[4-[(naphthalen-2-ylmethylamino)methyl]cyclohexyl]methyl]naphthalene-2-sulfonamide.
| Compound Name | N-[[4-[(naphthalen-2-ylmethylamino)methyl]cyclohexyl]methyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 10005032 |
| Molecular Formula | C29H32N2O2S |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | N-[[4-[(naphthalen-2-ylmethylamino)methyl]cyclohexyl]methyl]naphthalene-2-sulfonamide |
| SMILES | O=S(=O)(NCC1CCC(CNCc2ccc3ccccc3c2)CC1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C29H32N2O2S/c32-34(33,29-16-15-26-6-2-4-8-28(26)18-29)31-21-23-11-9-22(10-12-23)19-30-20-24-13-14-25-5-1-3-7-27(25)17-24/h1-8,13-18,22-23,30-31H,9-12,19-21H2 |
| InChIKey | RAXITVOBPBHKDQ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |