C15H26ClN3O12 — CID 10005173
1-(2-chloroethyl)-3-[[(2R,3S,4S,5R,6R)-6-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl]-1-nitrosourea (PubChem CID 10005173) has the molecular formula C15H26ClN3O12 and a molecular weight of 475.84 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-[[(2R,3S,4S,5R,6R)-6-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl]-1-nitrosourea.
| Compound Name | 1-(2-chloroethyl)-3-[[(2R,3S,4S,5R,6R)-6-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl]-1-nitrosourea |
|---|---|
| PubChem CID | 10005173 |
| Molecular Formula | C15H26ClN3O12 |
| Molecular Weight | 475.84 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 1-(2-chloroethyl)-3-[[(2R,3S,4S,5R,6R)-6-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl]-1-nitrosourea |
| SMILES | O=NN(CCCl)C(=O)NC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H26ClN3O12/c16-1-2-19(18-28)14(27)17-3-6-8(22)10(24)11(25)13(29-6)31-15(5-21)12(26)9(23)7(4-20)30-15/h6-13,20-26H,1-5H2,(H,17,27)/t6-,7-,8-,9-,10+,11-,12+,13-,15+/m1/s1 |
| InChIKey | YHOJMYRCVSJYLD-INMDXKLXSA-N |
| XLogP | -4.46 |
| TPSA | 231.07 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.84 |
| LogP ≤ 5 | -4.46 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|