C27H43O5P — CID 10005298
(E)-1-(3,5-ditert-butyl-4-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-4-diethoxyphosphorylpent-1-en-3-one (PubChem CID 10005298) has the molecular formula C27H43O5P and a molecular weight of 478.61 g/mol. Its IUPAC name is (E)-1-(3,5-ditert-butyl-4-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-4-diethoxyphosphorylpent-1-en-3-one.
| Compound Name | (E)-1-(3,5-ditert-butyl-4-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-4-diethoxyphosphorylpent-1-en-3-one |
|---|---|
| PubChem CID | 10005298 |
| Molecular Formula | C27H43O5P |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | (E)-1-(3,5-ditert-butyl-4-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-4-diethoxyphosphorylpent-1-en-3-one |
| SMILES | CCOP(=O)(OCC)C(C)C(=O)/C=C/c1cc(C(C)(C)C)c(O)c2c1CCCC2C(C)(C)C |
| InChI | InChI=1S/C27H43O5P/c1-10-31-33(30,32-11-2)18(3)23(28)16-15-19-17-22(27(7,8)9)25(29)24-20(19)13-12-14-21(24)26(4,5)6/h15-18,21,29H,10-14H2,1-9H3/b16-15+ |
| InChIKey | QUVXSTFQWZMPGU-FOCLMDBBSA-N |
| XLogP | 7.39 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|