C15H14F3N5OS — CID 1000546
4-(4-methoxyphenyl)-3-[[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 1000546) has the molecular formula C15H14F3N5OS and a molecular weight of 369.37 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-3-[[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(4-methoxyphenyl)-3-[[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 1000546 |
| Molecular Formula | C15H14F3N5OS |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 4-(4-methoxyphenyl)-3-[[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | COc1ccc(-n2c(Cn3nc(C(F)(F)F)cc3C)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C15H14F3N5OS/c1-9-7-12(15(16,17)18)21-22(9)8-13-19-20-14(25)23(13)10-3-5-11(24-2)6-4-10/h3-7H,8H2,1-2H3,(H,20,25) |
| InChIKey | MOUPBNQSBKZOCI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 60.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|