C25H24N6O5 — CID 10005715
(E)-3-[4-[[[8-carbamoyl-7-(3,5-dimethoxyanilino)imidazo[1,2-c]pyrimidin-5-yl]amino]methyl]phenyl]prop-2-enoic acid (PubChem CID 10005715) has the molecular formula C25H24N6O5 and a molecular weight of 488.50 g/mol. Its IUPAC name is (E)-3-[4-[[[8-carbamoyl-7-(3,5-dimethoxyanilino)imidazo[1,2-c]pyrimidin-5-yl]amino]methyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[[8-carbamoyl-7-(3,5-dimethoxyanilino)imidazo[1,2-c]pyrimidin-5-yl]amino]methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 10005715 |
| Molecular Formula | C25H24N6O5 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | (E)-3-[4-[[[8-carbamoyl-7-(3,5-dimethoxyanilino)imidazo[1,2-c]pyrimidin-5-yl]amino]methyl]phenyl]prop-2-enoic acid |
| SMILES | COc1cc(Nc2nc(NCc3ccc(/C=C/C(=O)O)cc3)n3ccnc3c2C(N)=O)cc(OC)c1 |
| InChI | InChI=1S/C25H24N6O5/c1-35-18-11-17(12-19(13-18)36-2)29-23-21(22(26)34)24-27-9-10-31(24)25(30-23)28-14-16-5-3-15(4-6-16)7-8-20(32)33/h3-13,29H,14H2,1-2H3,(H2,26,34)(H,28,30)(H,32,33)/b8-7+ |
| InChIKey | LPKOEWTZGVUEJF-BQYQJAHWSA-N |
| XLogP | 3.30 |
| TPSA | 153.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|