C23H19ClF3N5O2 — CID 10005778
7-(3-chloro-2-pyridinyl)-2-(2-methoxyethoxymethyl)-N-[4-(trifluoromethyl)phenyl]pyrido[2,3-d]pyrimidin-4-amine (PubChem CID 10005778) has the molecular formula C23H19ClF3N5O2 and a molecular weight of 489.89 g/mol. Its IUPAC name is 7-(3-chloro-2-pyridinyl)-2-(2-methoxyethoxymethyl)-N-[4-(trifluoromethyl)phenyl]pyrido[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-(3-chloro-2-pyridinyl)-2-(2-methoxyethoxymethyl)-N-[4-(trifluoromethyl)phenyl]pyrido[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 10005778 |
| Molecular Formula | C23H19ClF3N5O2 |
| Molecular Weight | 489.89 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 7-(3-chloro-2-pyridinyl)-2-(2-methoxyethoxymethyl)-N-[4-(trifluoromethyl)phenyl]pyrido[2,3-d]pyrimidin-4-amine |
| SMILES | COCCOCc1nc(Nc2ccc(C(F)(F)F)cc2)c2ccc(-c3ncccc3Cl)nc2n1 |
| InChI | InChI=1S/C23H19ClF3N5O2/c1-33-11-12-34-13-19-31-21(29-15-6-4-14(5-7-15)23(25,26)27)16-8-9-18(30-22(16)32-19)20-17(24)3-2-10-28-20/h2-10H,11-13H2,1H3,(H,29,30,31,32) |
| InChIKey | VIJAKNKYFOKYSZ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.89 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|