About 3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-2-methyl-4-phenylisoquinolin-1-one
3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-2-methyl-4-phenylisoquinolin-1-one (PubChem CID 10005824) has the molecular formula C26H19F6NO2
and a molecular weight of 491.43 g/mol. Its IUPAC name is 3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-2-methyl-4-phenylisoquinolin-1-one.
Molecular Properties
| Compound Name | 3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-2-methyl-4-phenylisoquinolin-1-one |
| PubChem CID | 10005824 |
| Molecular Formula | C26H19F6NO2 |
| Molecular Weight | 491.43 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | 3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-2-methyl-4-phenylisoquinolin-1-one |
| SMILES | Cn1c(COCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c(-c2ccccc2)c2ccccc2c1=O |
| InChI | InChI=1S/C26H19F6NO2/c1-33-22(15-35-14-16-11-18(25(27,28)29)13-19(12-16)26(30,31)32)23(17-7-3-2-4-8-17)20-9-5-6-10-21(20)24(33)34/h2-13H,14-15H2,1H3 |
| InChIKey | VUMATGNDCCCSSB-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 491.43 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-2-methyl-4-phenylisoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-2-methyl-4-phenylisoquinolin-1-one?
The IUPAC name of 3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-2-methyl-4-phenylisoquinolin-1-one (CID 10005824) is 3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-2-methyl-4-phenylisoquinolin-1-one.
What is the SMILES notation for 3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-2-methyl-4-phenylisoquinolin-1-one?
The canonical SMILES for 3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-2-methyl-4-phenylisoquinolin-1-one is Cn1c(COCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c(-c2ccccc2)c2ccccc2c1=O.
What is the InChIKey of 3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-2-methyl-4-phenylisoquinolin-1-one?
The InChIKey is VUMATGNDCCCSSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H19F6NO2/c1-33-22(15-35-14-16-11-18(25(27,28)29)13-19(12-16)26(30,31)32)23(17-7-3-2-4-8-17)20-9-5-6-10-21(20)24(33)34/h2-13H,14-15H2,1H3.
What are the key properties of 3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-2-methyl-4-phenylisoquinolin-1-one?
3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-2-methyl-4-phenylisoquinolin-1-one has a molecular weight of 491.43 g/mol, XLogP of 6.96, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-2-methyl-4-phenylisoquinolin-1-one is sourced from PubChem (CID 10005824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).