C28H29NO5S — CID 10005841
[(1R,2S,3R,4S)-1,7,7-trimethyl-3-(naphthalen-1-ylsulfonylamino)-2-bicyclo[2.2.1]heptanyl] 2-oxo-2-phenylacetate (PubChem CID 10005841) has the molecular formula C28H29NO5S and a molecular weight of 491.61 g/mol. Its IUPAC name is [(1R,2S,3R,4S)-1,7,7-trimethyl-3-(naphthalen-1-ylsulfonylamino)-2-bicyclo[2.2.1]heptanyl] 2-oxo-2-phenylacetate.
| Compound Name | [(1R,2S,3R,4S)-1,7,7-trimethyl-3-(naphthalen-1-ylsulfonylamino)-2-bicyclo[2.2.1]heptanyl] 2-oxo-2-phenylacetate |
|---|---|
| PubChem CID | 10005841 |
| Molecular Formula | C28H29NO5S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | [(1R,2S,3R,4S)-1,7,7-trimethyl-3-(naphthalen-1-ylsulfonylamino)-2-bicyclo[2.2.1]heptanyl] 2-oxo-2-phenylacetate |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@H](OC(=O)C(=O)c1ccccc1)[C@@H]2NS(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C28H29NO5S/c1-27(2)21-16-17-28(27,3)25(34-26(31)24(30)19-11-5-4-6-12-19)23(21)29-35(32,33)22-15-9-13-18-10-7-8-14-20(18)22/h4-15,21,23,25,29H,16-17H2,1-3H3/t21-,23-,25-,28+/m1/s1 |
| InChIKey | NLLMACOUIDHBMK-FNIBFVHZSA-N |
| XLogP | 4.74 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|