C22H15F3N2O6S — CID 10005861
2-[4-methoxycarbonyl-1,3-dioxo-2-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl]isoquinolin-4-yl]acetic acid (PubChem CID 10005861) has the molecular formula C22H15F3N2O6S and a molecular weight of 492.43 g/mol. Its IUPAC name is 2-[4-methoxycarbonyl-1,3-dioxo-2-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl]isoquinolin-4-yl]acetic acid.
| Compound Name | 2-[4-methoxycarbonyl-1,3-dioxo-2-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl]isoquinolin-4-yl]acetic acid |
|---|---|
| PubChem CID | 10005861 |
| Molecular Formula | C22H15F3N2O6S |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | 2-[4-methoxycarbonyl-1,3-dioxo-2-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl]isoquinolin-4-yl]acetic acid |
| SMILES | COC(=O)C1(CC(=O)O)C(=O)N(Cc2nc3cc(C(F)(F)F)ccc3s2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C22H15F3N2O6S/c1-33-20(32)21(9-17(28)29)13-5-3-2-4-12(13)18(30)27(19(21)31)10-16-26-14-8-11(22(23,24)25)6-7-15(14)34-16/h2-8H,9-10H2,1H3,(H,28,29) |
| InChIKey | JLCAYYNYMHFILN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|