C21H26F3N7O4 — CID 10006062
N-[(2R)-2-[[[5-(anilinocarbamoyl)-4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide (PubChem CID 10006062) has the molecular formula C21H26F3N7O4 and a molecular weight of 497.48 g/mol. Its IUPAC name is N-[(2R)-2-[[[5-(anilinocarbamoyl)-4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-2-[[[5-(anilinocarbamoyl)-4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 10006062 |
| Molecular Formula | C21H26F3N7O4 |
| Molecular Weight | 497.48 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | N-[(2R)-2-[[[5-(anilinocarbamoyl)-4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide |
| SMILES | CCCCC[C@H](CN(O)C=O)C(=O)NNc1ncc(C(=O)NNc2ccccc2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C21H26F3N7O4/c1-2-3-5-8-14(12-31(35)13-32)18(33)28-30-20-25-11-16(17(26-20)21(22,23)24)19(34)29-27-15-9-6-4-7-10-15/h4,6-7,9-11,13-14,27,35H,2-3,5,8,12H2,1H3,(H,28,33)(H,29,34)(H,25,26,30)/t14-/m1/s1 |
| InChIKey | ORPNESXGPKURTB-CQSZACIVSA-N |
| XLogP | 2.74 |
| TPSA | 148.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|