About (3S,4S)-4-(4-chlorophenyl)-3,4-bis[(3-nitrophenyl)methoxy]piperidine
(3S,4S)-4-(4-chlorophenyl)-3,4-bis[(3-nitrophenyl)methoxy]piperidine (PubChem CID 10006077) has the molecular formula C25H24ClN3O6
and a molecular weight of 497.94 g/mol. Its IUPAC name is (3S,4S)-4-(4-chlorophenyl)-3,4-bis[(3-nitrophenyl)methoxy]piperidine.
Molecular Properties
| Compound Name | (3S,4S)-4-(4-chlorophenyl)-3,4-bis[(3-nitrophenyl)methoxy]piperidine |
| PubChem CID | 10006077 |
| Molecular Formula | C25H24ClN3O6 |
| Molecular Weight | 497.94 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | (3S,4S)-4-(4-chlorophenyl)-3,4-bis[(3-nitrophenyl)methoxy]piperidine |
| SMILES | O=[N+]([O-])c1cccc(CO[C@H]2CNCC[C@]2(OCc2cccc([N+](=O)[O-])c2)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C25H24ClN3O6/c26-21-9-7-20(8-10-21)25(35-17-19-4-2-6-23(14-19)29(32)33)11-12-27-15-24(25)34-16-18-3-1-5-22(13-18)28(30)31/h1-10,13-14,24,27H,11-12,15-17H2/t24-,25-/m0/s1 |
| InChIKey | YYLAILLWAVQIAS-DQEYMECFSA-N |
| XLogP | 5.15 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 497.94 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3S,4S)-4-(4-chlorophenyl)-3,4-bis[(3-nitrophenyl)methoxy]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-4-(4-chlorophenyl)-3,4-bis[(3-nitrophenyl)methoxy]piperidine?
The IUPAC name of (3S,4S)-4-(4-chlorophenyl)-3,4-bis[(3-nitrophenyl)methoxy]piperidine (CID 10006077) is (3S,4S)-4-(4-chlorophenyl)-3,4-bis[(3-nitrophenyl)methoxy]piperidine.
What is the SMILES notation for (3S,4S)-4-(4-chlorophenyl)-3,4-bis[(3-nitrophenyl)methoxy]piperidine?
The canonical SMILES for (3S,4S)-4-(4-chlorophenyl)-3,4-bis[(3-nitrophenyl)methoxy]piperidine is O=[N+]([O-])c1cccc(CO[C@H]2CNCC[C@]2(OCc2cccc([N+](=O)[O-])c2)c2ccc(Cl)cc2)c1.
What is the InChIKey of (3S,4S)-4-(4-chlorophenyl)-3,4-bis[(3-nitrophenyl)methoxy]piperidine?
The InChIKey is YYLAILLWAVQIAS-DQEYMECFSA-N. The full InChI is InChI=1S/C25H24ClN3O6/c26-21-9-7-20(8-10-21)25(35-17-19-4-2-6-23(14-19)29(32)33)11-12-27-15-24(25)34-16-18-3-1-5-22(13-18)28(30)31/h1-10,13-14,24,27H,11-12,15-17H2/t24-,25-/m0/s1.
What are the key properties of (3S,4S)-4-(4-chlorophenyl)-3,4-bis[(3-nitrophenyl)methoxy]piperidine?
(3S,4S)-4-(4-chlorophenyl)-3,4-bis[(3-nitrophenyl)methoxy]piperidine has a molecular weight of 497.94 g/mol, XLogP of 5.15, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-4-(4-chlorophenyl)-3,4-bis[(3-nitrophenyl)methoxy]piperidine is sourced from PubChem (CID 10006077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).