C23H22F2N2O2 — CID 1000619
(E)-3-(4-fluorophenyl)-1-[4-[(E)-3-(4-fluorophenyl)prop-2-enoyl]-1,4-diazepan-1-yl]prop-2-en-1-one (PubChem CID 1000619) has the molecular formula C23H22F2N2O2 and a molecular weight of 396.44 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-1-[4-[(E)-3-(4-fluorophenyl)prop-2-enoyl]-1,4-diazepan-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-fluorophenyl)-1-[4-[(E)-3-(4-fluorophenyl)prop-2-enoyl]-1,4-diazepan-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 1000619 |
| Molecular Formula | C23H22F2N2O2 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-1-[4-[(E)-3-(4-fluorophenyl)prop-2-enoyl]-1,4-diazepan-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(F)cc1)N1CCCN(C(=O)/C=C/c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H22F2N2O2/c24-20-8-2-18(3-9-20)6-12-22(28)26-14-1-15-27(17-16-26)23(29)13-7-19-4-10-21(25)11-5-19/h2-13H,1,14-17H2/b12-6+,13-7+ |
| InChIKey | XLZDLIJWXXAFLL-PWHKKFIBSA-N |
| XLogP | 3.75 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|