C28H48O4Si2 — CID 10006339
(4R,6R)-6-[2-[(1S,2S,6S,8aR)-2,6-dimethyl-8-trimethylsilyloxy-1,2,6,8a-tetrahydronaphthalen-1-yl]ethyl]-4-[tert-butyl(dimethyl)silyl]oxyoxan-2-one (PubChem CID 10006339) has the molecular formula C28H48O4Si2 and a molecular weight of 504.86 g/mol. Its IUPAC name is (4R,6R)-6-[2-[(1S,2S,6S,8aR)-2,6-dimethyl-8-trimethylsilyloxy-1,2,6,8a-tetrahydronaphthalen-1-yl]ethyl]-4-[tert-butyl(dimethyl)silyl]oxyoxan-2-one.
| Compound Name | (4R,6R)-6-[2-[(1S,2S,6S,8aR)-2,6-dimethyl-8-trimethylsilyloxy-1,2,6,8a-tetrahydronaphthalen-1-yl]ethyl]-4-[tert-butyl(dimethyl)silyl]oxyoxan-2-one |
|---|---|
| PubChem CID | 10006339 |
| Molecular Formula | C28H48O4Si2 |
| Molecular Weight | 504.86 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | (4R,6R)-6-[2-[(1S,2S,6S,8aR)-2,6-dimethyl-8-trimethylsilyloxy-1,2,6,8a-tetrahydronaphthalen-1-yl]ethyl]-4-[tert-butyl(dimethyl)silyl]oxyoxan-2-one |
| SMILES | C[C@H]1C=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)O3)[C@H]2C(O[Si](C)(C)C)=C1 |
| InChI | InChI=1S/C28H48O4Si2/c1-19-15-21-12-11-20(2)24(27(21)25(16-19)32-33(6,7)8)14-13-22-17-23(18-26(29)30-22)31-34(9,10)28(3,4)5/h11-12,15-16,19-20,22-24,27H,13-14,17-18H2,1-10H3/t19-,20-,22+,23+,24-,27-/m0/s1 |
| InChIKey | KMDMMVFKMMQHIS-CPUAHJQSSA-N |
| XLogP | 7.61 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.86 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|