C27H33ClO5S — CID 10006340
(Z)-7-[(1R,4S,5R)-5-[(E)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoic acid (PubChem CID 10006340) has the molecular formula C27H33ClO5S and a molecular weight of 505.08 g/mol. Its IUPAC name is (Z)-7-[(1R,4S,5R)-5-[(E)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,4S,5R)-5-[(E)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 10006340 |
| Molecular Formula | C27H33ClO5S |
| Molecular Weight | 505.08 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | (Z)-7-[(1R,4S,5R)-5-[(E)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CC1(C)C(=O)[C@H](C/C=C\CCCC(=O)O)[C@@H](/C=C/C(O)CCc2sc3ccccc3c2Cl)[C@@H]1O |
| InChI | InChI=1S/C27H33ClO5S/c1-27(2)25(32)18(9-5-3-4-6-12-23(30)31)19(26(27)33)15-13-17(29)14-16-22-24(28)20-10-7-8-11-21(20)34-22/h3,5,7-8,10-11,13,15,17-19,26,29,33H,4,6,9,12,14,16H2,1-2H3,(H,30,31)/b5-3-,15-13+/t17?,18-,19-,26+/m1/s1 |
| InChIKey | QUQXMMUGKYIUKZ-CJHMMKSESA-N |
| XLogP | 5.81 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.08 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|