C27H31N4O4S+ — CID 10006436
4-(1,3-benzodioxol-5-ylcarbamothioylamino)-N-[3-[3-(pyridin-1-ium-1-ylmethyl)phenoxy]propyl]butanamide (PubChem CID 10006436) has the molecular formula C27H31N4O4S+ and a molecular weight of 507.64 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylcarbamothioylamino)-N-[3-[3-(pyridin-1-ium-1-ylmethyl)phenoxy]propyl]butanamide.
| Compound Name | 4-(1,3-benzodioxol-5-ylcarbamothioylamino)-N-[3-[3-(pyridin-1-ium-1-ylmethyl)phenoxy]propyl]butanamide |
|---|---|
| PubChem CID | 10006436 |
| Molecular Formula | C27H31N4O4S+ |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylcarbamothioylamino)-N-[3-[3-(pyridin-1-ium-1-ylmethyl)phenoxy]propyl]butanamide |
| SMILES | O=C(CCCNC(=S)Nc1ccc2c(c1)OCO2)NCCCOc1cccc(C[n+]2ccccc2)c1 |
| InChI | InChI=1S/C27H30N4O4S/c32-26(9-5-12-29-27(36)30-22-10-11-24-25(18-22)35-20-34-24)28-13-6-16-33-23-8-4-7-21(17-23)19-31-14-2-1-3-15-31/h1-4,7-8,10-11,14-15,17-18H,5-6,9,12-13,16,19-20H2,(H2-,28,29,30,32,36)/p+1 |
| InChIKey | HKBNPEVAQWTIJO-UHFFFAOYSA-O |
| XLogP | 3.40 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|