C25H27BN2O3S3 — CID 10006544
S-phenyl 5,5-dimethyl-2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]-4H-1,3-thiazole-4-carbothioate (PubChem CID 10006544) has the molecular formula C25H27BN2O3S3 and a molecular weight of 510.52 g/mol. Its IUPAC name is S-phenyl 5,5-dimethyl-2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]-4H-1,3-thiazole-4-carbothioate.
| Compound Name | S-phenyl 5,5-dimethyl-2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]-4H-1,3-thiazole-4-carbothioate |
|---|---|
| PubChem CID | 10006544 |
| Molecular Formula | C25H27BN2O3S3 |
| Molecular Weight | 510.52 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | S-phenyl 5,5-dimethyl-2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]-4H-1,3-thiazole-4-carbothioate |
| SMILES | CC1(C)SC(c2nc3ccc(B4OC(C)(C)C(C)(C)O4)cc3s2)=NC1C(=O)Sc1ccccc1 |
| InChI | InChI=1S/C25H27BN2O3S3/c1-23(2)19(22(29)32-16-10-8-7-9-11-16)28-21(34-23)20-27-17-13-12-15(14-18(17)33-20)26-30-24(3,4)25(5,6)31-26/h7-14,19H,1-6H3 |
| InChIKey | CBIIYAMYQKCWAJ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 60.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.52 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|