C26H44N2O8 — CID 10006629
[(3R,6S)-7-oxo-6-[[(E,2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-6,8,8-trimethylnon-6-enoyl]amino]azepan-3-yl] cyclohexanecarboxylate (PubChem CID 10006629) has the molecular formula C26H44N2O8 and a molecular weight of 512.64 g/mol. Its IUPAC name is [(3R,6S)-7-oxo-6-[[(E,2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-6,8,8-trimethylnon-6-enoyl]amino]azepan-3-yl] cyclohexanecarboxylate.
| Compound Name | [(3R,6S)-7-oxo-6-[[(E,2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-6,8,8-trimethylnon-6-enoyl]amino]azepan-3-yl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 10006629 |
| Molecular Formula | C26H44N2O8 |
| Molecular Weight | 512.64 g/mol |
| Exact Mass | 512.31 |
| IUPAC Name | [(3R,6S)-7-oxo-6-[[(E,2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-6,8,8-trimethylnon-6-enoyl]amino]azepan-3-yl] cyclohexanecarboxylate |
| SMILES | CO[C@@H](C(=O)N[C@H]1CC[C@@H](OC(=O)C2CCCCC2)CNC1=O)[C@H](O)[C@@H](O)[C@H](O)/C(C)=C/C(C)(C)C |
| InChI | InChI=1S/C26H44N2O8/c1-15(13-26(2,3)4)19(29)20(30)21(31)22(35-5)24(33)28-18-12-11-17(14-27-23(18)32)36-25(34)16-9-7-6-8-10-16/h13,16-22,29-31H,6-12,14H2,1-5H3,(H,27,32)(H,28,33)/b15-13+/t17-,18+,19-,20+,21-,22-/m1/s1 |
| InChIKey | KPRFHISDQHTCOC-MTXMZVTLSA-N |
| XLogP | 0.96 |
| TPSA | 154.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.64 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|