C30H34N4O4 — CID 10006693
methyl 2-[4-[[2-butyl-5-[(E)-(3-butyl-2,5-dioxoimidazolidin-4-ylidene)methyl]imidazol-1-yl]methyl]phenyl]benzoate (PubChem CID 10006693) has the molecular formula C30H34N4O4 and a molecular weight of 514.63 g/mol. Its IUPAC name is methyl 2-[4-[[2-butyl-5-[(E)-(3-butyl-2,5-dioxoimidazolidin-4-ylidene)methyl]imidazol-1-yl]methyl]phenyl]benzoate.
| Compound Name | methyl 2-[4-[[2-butyl-5-[(E)-(3-butyl-2,5-dioxoimidazolidin-4-ylidene)methyl]imidazol-1-yl]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 10006693 |
| Molecular Formula | C30H34N4O4 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | methyl 2-[4-[[2-butyl-5-[(E)-(3-butyl-2,5-dioxoimidazolidin-4-ylidene)methyl]imidazol-1-yl]methyl]phenyl]benzoate |
| SMILES | CCCCc1ncc(/C=C2\C(=O)NC(=O)N2CCCC)n1Cc1ccc(-c2ccccc2C(=O)OC)cc1 |
| InChI | InChI=1S/C30H34N4O4/c1-4-6-12-27-31-19-23(18-26-28(35)32-30(37)33(26)17-7-5-2)34(27)20-21-13-15-22(16-14-21)24-10-8-9-11-25(24)29(36)38-3/h8-11,13-16,18-19H,4-7,12,17,20H2,1-3H3,(H,32,35,37)/b26-18+ |
| InChIKey | QWDAOLJZTCHRAW-NLRVBDNBSA-N |
| XLogP | 5.42 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|