C30H44O7 — CID 10006772
[(1R,3E,5R,7S,10Z,12S,13S,14S)-1-acetyloxy-10-(acetyloxymethyl)-3,6,6,14-tetramethyl-2-oxo-13-tricyclo[10.3.0.05,7]pentadeca-3,10-dienyl] hexanoate (PubChem CID 10006772) has the molecular formula C30H44O7 and a molecular weight of 516.68 g/mol. Its IUPAC name is [(1R,3E,5R,7S,10Z,12S,13S,14S)-1-acetyloxy-10-(acetyloxymethyl)-3,6,6,14-tetramethyl-2-oxo-13-tricyclo[10.3.0.05,7]pentadeca-3,10-dienyl] hexanoate.
| Compound Name | [(1R,3E,5R,7S,10Z,12S,13S,14S)-1-acetyloxy-10-(acetyloxymethyl)-3,6,6,14-tetramethyl-2-oxo-13-tricyclo[10.3.0.05,7]pentadeca-3,10-dienyl] hexanoate |
|---|---|
| PubChem CID | 10006772 |
| Molecular Formula | C30H44O7 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | [(1R,3E,5R,7S,10Z,12S,13S,14S)-1-acetyloxy-10-(acetyloxymethyl)-3,6,6,14-tetramethyl-2-oxo-13-tricyclo[10.3.0.05,7]pentadeca-3,10-dienyl] hexanoate |
| SMILES | CCCCCC(=O)O[C@H]1[C@@H](C)C[C@]2(OC(C)=O)C(=O)/C(C)=C/[C@@H]3[C@H](CC/C(COC(C)=O)=C/[C@@H]12)C3(C)C |
| InChI | InChI=1S/C30H44O7/c1-8-9-10-11-26(33)36-27-19(3)16-30(37-21(5)32)25(27)15-22(17-35-20(4)31)12-13-23-24(29(23,6)7)14-18(2)28(30)34/h14-15,19,23-25,27H,8-13,16-17H2,1-7H3/b18-14+,22-15-/t19-,23-,24+,25-,27-,30+/m0/s1 |
| InChIKey | LVHGDNSXSOKXTG-BAVJBBMESA-N |
| XLogP | 5.51 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|