C32H52O5 — CID 10006778
(1R,5R,8S,11R,14S,17R,20R,21R,23R,24R)-23-ethoxy-20-hydroxy-5,8,11,14,17,24-hexamethyl-22-oxahexacyclo[19.2.1.01,18.04,17.05,14.08,13]tetracosane-11-carboxylic acid (PubChem CID 10006778) has the molecular formula C32H52O5 and a molecular weight of 516.76 g/mol. Its IUPAC name is (1R,5R,8S,11R,14S,17R,20R,21R,23R,24R)-23-ethoxy-20-hydroxy-5,8,11,14,17,24-hexamethyl-22-oxahexacyclo[19.2.1.01,18.04,17.05,14.08,13]tetracosane-11-carboxylic acid.
| Compound Name | (1R,5R,8S,11R,14S,17R,20R,21R,23R,24R)-23-ethoxy-20-hydroxy-5,8,11,14,17,24-hexamethyl-22-oxahexacyclo[19.2.1.01,18.04,17.05,14.08,13]tetracosane-11-carboxylic acid |
|---|---|
| PubChem CID | 10006778 |
| Molecular Formula | C32H52O5 |
| Molecular Weight | 516.76 g/mol |
| Exact Mass | 516.38 |
| IUPAC Name | (1R,5R,8S,11R,14S,17R,20R,21R,23R,24R)-23-ethoxy-20-hydroxy-5,8,11,14,17,24-hexamethyl-22-oxahexacyclo[19.2.1.01,18.04,17.05,14.08,13]tetracosane-11-carboxylic acid |
| SMILES | CCO[C@@H]1O[C@H]2[C@H](O)CC3[C@]4(C)CC[C@@]5(C)C6C[C@](C)(C(=O)O)CC[C@]6(C)CC[C@]5(C)C4CC[C@]31[C@H]2C |
| InChI | InChI=1S/C32H52O5/c1-8-36-26-32-10-9-21-29(5,22(32)17-20(33)24(37-26)19(32)2)14-16-31(7)23-18-28(4,25(34)35)12-11-27(23,3)13-15-30(21,31)6/h19-24,26,33H,8-18H2,1-7H3,(H,34,35)/t19-,20+,21?,22?,23?,24+,26+,27+,28+,29+,30+,31-,32-/m0/s1 |
| InChIKey | MILUXBBEUPIOMH-NGAFZIQCSA-N |
| XLogP | 6.66 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.76 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |