C27H38N2O8 — CID 10006824
[(2R,3S,6S,7R,8R)-8-butyl-3-[(3-formamido-2-methylbenzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 3-methylbutanoate (PubChem CID 10006824) has the molecular formula C27H38N2O8 and a molecular weight of 518.61 g/mol. Its IUPAC name is [(2R,3S,6S,7R,8R)-8-butyl-3-[(3-formamido-2-methylbenzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 3-methylbutanoate.
| Compound Name | [(2R,3S,6S,7R,8R)-8-butyl-3-[(3-formamido-2-methylbenzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 10006824 |
| Molecular Formula | C27H38N2O8 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | [(2R,3S,6S,7R,8R)-8-butyl-3-[(3-formamido-2-methylbenzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 3-methylbutanoate |
| SMILES | CCCC[C@H]1C(=O)O[C@H](C)[C@H](NC(=O)c2cccc(NC=O)c2C)C(=O)O[C@@H](C)[C@@H]1OC(=O)CC(C)C |
| InChI | InChI=1S/C27H38N2O8/c1-7-8-10-20-24(37-22(31)13-15(2)3)18(6)36-27(34)23(17(5)35-26(20)33)29-25(32)19-11-9-12-21(16(19)4)28-14-30/h9,11-12,14-15,17-18,20,23-24H,7-8,10,13H2,1-6H3,(H,28,30)(H,29,32)/t17-,18+,20-,23+,24+/m1/s1 |
| InChIKey | YJMXCRUELCGQOS-CPYVPJLFSA-N |
| XLogP | 3.30 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|