C26H33F2N2O5P — CID 10006957
6-[(5S)-3-benzyl-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxoimidazolidin-1-yl]hexylphosphonic acid (PubChem CID 10006957) has the molecular formula C26H33F2N2O5P and a molecular weight of 522.53 g/mol. Its IUPAC name is 6-[(5S)-3-benzyl-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxoimidazolidin-1-yl]hexylphosphonic acid.
| Compound Name | 6-[(5S)-3-benzyl-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxoimidazolidin-1-yl]hexylphosphonic acid |
|---|---|
| PubChem CID | 10006957 |
| Molecular Formula | C26H33F2N2O5P |
| Molecular Weight | 522.53 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | 6-[(5S)-3-benzyl-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxoimidazolidin-1-yl]hexylphosphonic acid |
| SMILES | O=C1N(Cc2ccccc2)C[C@H](/C=C/C(O)C(F)(F)c2ccccc2)N1CCCCCCP(=O)(O)O |
| InChI | InChI=1S/C26H33F2N2O5P/c27-26(28,22-13-7-4-8-14-22)24(31)16-15-23-20-29(19-21-11-5-3-6-12-21)25(32)30(23)17-9-1-2-10-18-36(33,34)35/h3-8,11-16,23-24,31H,1-2,9-10,17-20H2,(H2,33,34,35)/b16-15+/t23-,24?/m0/s1 |
| InChIKey | CHGOMBXOBZYXER-ZFRPQTKASA-N |
| XLogP | 4.74 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|