C17H18N4O7S — CID 10006999
methyl 9-oxo-4-(2-phenylethyl)-10-sulfooxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-diene-7-carboxylate (PubChem CID 10006999) has the molecular formula C17H18N4O7S and a molecular weight of 422.42 g/mol. Its IUPAC name is methyl 9-oxo-4-(2-phenylethyl)-10-sulfooxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-diene-7-carboxylate.
| Compound Name | methyl 9-oxo-4-(2-phenylethyl)-10-sulfooxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-diene-7-carboxylate |
|---|---|
| PubChem CID | 10006999 |
| Molecular Formula | C17H18N4O7S |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | methyl 9-oxo-4-(2-phenylethyl)-10-sulfooxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-diene-7-carboxylate |
| SMILES | COC(=O)C1c2nn(CCc3ccccc3)cc2C2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C17H18N4O7S/c1-27-16(22)15-14-12(9-19(18-14)8-7-11-5-3-2-4-6-11)13-10-20(15)17(23)21(13)28-29(24,25)26/h2-6,9,13,15H,7-8,10H2,1H3,(H,24,25,26) |
| InChIKey | JKJMTVZZRUMGGD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 131.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|