C27H41N3O8 — CID 10007334
[(3aS,5S,6R,6aS)-3a-(heptoxymethyl)-2,2-dimethyl-5-(pyrrolidin-1-ylmethyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl] N-(4-nitrophenyl)carbamate (PubChem CID 10007334) has the molecular formula C27H41N3O8 and a molecular weight of 535.64 g/mol. Its IUPAC name is [(3aS,5S,6R,6aS)-3a-(heptoxymethyl)-2,2-dimethyl-5-(pyrrolidin-1-ylmethyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl] N-(4-nitrophenyl)carbamate.
| Compound Name | [(3aS,5S,6R,6aS)-3a-(heptoxymethyl)-2,2-dimethyl-5-(pyrrolidin-1-ylmethyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl] N-(4-nitrophenyl)carbamate |
|---|---|
| PubChem CID | 10007334 |
| Molecular Formula | C27H41N3O8 |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.29 |
| IUPAC Name | [(3aS,5S,6R,6aS)-3a-(heptoxymethyl)-2,2-dimethyl-5-(pyrrolidin-1-ylmethyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl] N-(4-nitrophenyl)carbamate |
| SMILES | CCCCCCCOC[C@@]12O[C@@H](CN3CCCC3)[C@@H](OC(=O)Nc3ccc([N+](=O)[O-])cc3)[C@@H]1OC(C)(C)O2 |
| InChI | InChI=1S/C27H41N3O8/c1-4-5-6-7-10-17-34-19-27-24(37-26(2,3)38-27)23(22(36-27)18-29-15-8-9-16-29)35-25(31)28-20-11-13-21(14-12-20)30(32)33/h11-14,22-24H,4-10,15-19H2,1-3H3,(H,28,31)/t22-,23+,24-,27-/m0/s1 |
| InChIKey | HGAUTGZRYRHPFT-LAOBSVPGSA-N |
| XLogP | 4.84 |
| TPSA | 121.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|