C29H30N8O3 — CID 10007424
4-[(4-methylpiperazin-1-yl)methyl]-N-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]-3-nitrobenzamide (PubChem CID 10007424) has the molecular formula C29H30N8O3 and a molecular weight of 538.61 g/mol. Its IUPAC name is 4-[(4-methylpiperazin-1-yl)methyl]-N-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]-3-nitrobenzamide.
| Compound Name | 4-[(4-methylpiperazin-1-yl)methyl]-N-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 10007424 |
| Molecular Formula | C29H30N8O3 |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | 4-[(4-methylpiperazin-1-yl)methyl]-N-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]-3-nitrobenzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(CN3CCN(C)CC3)c([N+](=O)[O-])c2)cc1Nc1nccc(-c2cccnc2)n1 |
| InChI | InChI=1S/C29H30N8O3/c1-20-5-8-24(17-26(20)34-29-31-11-9-25(33-29)22-4-3-10-30-18-22)32-28(38)21-6-7-23(27(16-21)37(39)40)19-36-14-12-35(2)13-15-36/h3-11,16-18H,12-15,19H2,1-2H3,(H,32,38)(H,31,33,34) |
| InChIKey | HJHDSGUMDNJQMH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 129.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|