C31H34ClN3O4 — CID 10007659
4-[4-[(2S,4R)-4-(N-acetyl-4-chloroanilino)-2-methyl-3,4-dihydro-2H-quinoline-1-carbonyl]phenoxy]-N-ethylbutanamide (PubChem CID 10007659) has the molecular formula C31H34ClN3O4 and a molecular weight of 548.08 g/mol. Its IUPAC name is 4-[4-[(2S,4R)-4-(N-acetyl-4-chloroanilino)-2-methyl-3,4-dihydro-2H-quinoline-1-carbonyl]phenoxy]-N-ethylbutanamide.
| Compound Name | 4-[4-[(2S,4R)-4-(N-acetyl-4-chloroanilino)-2-methyl-3,4-dihydro-2H-quinoline-1-carbonyl]phenoxy]-N-ethylbutanamide |
|---|---|
| PubChem CID | 10007659 |
| Molecular Formula | C31H34ClN3O4 |
| Molecular Weight | 548.08 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | 4-[4-[(2S,4R)-4-(N-acetyl-4-chloroanilino)-2-methyl-3,4-dihydro-2H-quinoline-1-carbonyl]phenoxy]-N-ethylbutanamide |
| SMILES | CCNC(=O)CCCOc1ccc(C(=O)N2c3ccccc3[C@H](N(C(C)=O)c3ccc(Cl)cc3)C[C@@H]2C)cc1 |
| InChI | InChI=1S/C31H34ClN3O4/c1-4-33-30(37)10-7-19-39-26-17-11-23(12-18-26)31(38)34-21(2)20-29(27-8-5-6-9-28(27)34)35(22(3)36)25-15-13-24(32)14-16-25/h5-6,8-9,11-18,21,29H,4,7,10,19-20H2,1-3H3,(H,33,37)/t21-,29+/m0/s1 |
| InChIKey | NNLOAUIUNCBHDH-KCWXNJEJSA-N |
| XLogP | 6.17 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.08 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|