C29H32N2O5SSi — CID 10007684
2-[(1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-nitro-1-phenyl-3-phenylsulfanylpropan-2-yl]isoindole-1,3-dione (PubChem CID 10007684) has the molecular formula C29H32N2O5SSi and a molecular weight of 548.74 g/mol. Its IUPAC name is 2-[(1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-nitro-1-phenyl-3-phenylsulfanylpropan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[(1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-nitro-1-phenyl-3-phenylsulfanylpropan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10007684 |
| Molecular Formula | C29H32N2O5SSi |
| Molecular Weight | 548.74 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | 2-[(1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-nitro-1-phenyl-3-phenylsulfanylpropan-2-yl]isoindole-1,3-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](c1ccccc1)[C@H](C(Sc1ccccc1)[N+](=O)[O-])N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C29H32N2O5SSi/c1-29(2,3)38(4,5)36-25(20-14-8-6-9-15-20)24(28(31(34)35)37-21-16-10-7-11-17-21)30-26(32)22-18-12-13-19-23(22)27(30)33/h6-19,24-25,28H,1-5H3/t24-,25+,28?/m1/s1 |
| InChIKey | HUVMYGIPFCPRQS-CRWLQCRJSA-N |
| XLogP | 6.81 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.74 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|