C33H47NO6 — CID 10007824
[(1S,2S,6R,14R,15R,16R)-5-(cyclopropylmethyl)-16-[(2S)-2-hydroxy-3,3-dimethylbutan-2-yl]-15-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-yl] propyl carbonate (PubChem CID 10007824) has the molecular formula C33H47NO6 and a molecular weight of 553.74 g/mol. Its IUPAC name is [(1S,2S,6R,14R,15R,16R)-5-(cyclopropylmethyl)-16-[(2S)-2-hydroxy-3,3-dimethylbutan-2-yl]-15-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-yl] propyl carbonate.
| Compound Name | [(1S,2S,6R,14R,15R,16R)-5-(cyclopropylmethyl)-16-[(2S)-2-hydroxy-3,3-dimethylbutan-2-yl]-15-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-yl] propyl carbonate |
|---|---|
| PubChem CID | 10007824 |
| Molecular Formula | C33H47NO6 |
| Molecular Weight | 553.74 g/mol |
| Exact Mass | 553.34 |
| IUPAC Name | [(1S,2S,6R,14R,15R,16R)-5-(cyclopropylmethyl)-16-[(2S)-2-hydroxy-3,3-dimethylbutan-2-yl]-15-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-yl] propyl carbonate |
| SMILES | CCCOC(=O)Oc1ccc2c3c1O[C@H]1[C@@]4(OC)CC[C@@]5(C[C@@H]4[C@](C)(O)C(C)(C)C)[C@@H](C2)N(CC2CC2)CC[C@]315 |
| InChI | InChI=1S/C33H47NO6/c1-7-16-38-28(35)39-22-11-10-21-17-24-31-12-13-33(37-6,23(18-31)30(5,36)29(2,3)4)27-32(31,25(21)26(22)40-27)14-15-34(24)19-20-8-9-20/h10-11,20,23-24,27,36H,7-9,12-19H2,1-6H3/t23-,24-,27-,30+,31-,32+,33-/m1/s1 |
| InChIKey | NCZOFBNYPGJQOQ-WTFMMPAESA-N |
| XLogP | 5.63 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.74 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|