About methyl 2-[4-[3,3-bis[3-(trifluoromethyl)phenyl]prop-2-enylsulfanyl]-2-ethylphenoxy]acetate
methyl 2-[4-[3,3-bis[3-(trifluoromethyl)phenyl]prop-2-enylsulfanyl]-2-ethylphenoxy]acetate (PubChem CID 10007839) has the molecular formula C28H24F6O3S
and a molecular weight of 554.55 g/mol. Its IUPAC name is methyl 2-[4-[3,3-bis[3-(trifluoromethyl)phenyl]prop-2-enylsulfanyl]-2-ethylphenoxy]acetate.
Molecular Properties
| Compound Name | methyl 2-[4-[3,3-bis[3-(trifluoromethyl)phenyl]prop-2-enylsulfanyl]-2-ethylphenoxy]acetate |
| PubChem CID | 10007839 |
| Molecular Formula | C28H24F6O3S |
| Molecular Weight | 554.55 g/mol |
| Exact Mass | 554.14 |
| IUPAC Name | methyl 2-[4-[3,3-bis[3-(trifluoromethyl)phenyl]prop-2-enylsulfanyl]-2-ethylphenoxy]acetate |
| SMILES | CCc1cc(SCC=C(c2cccc(C(F)(F)F)c2)c2cccc(C(F)(F)F)c2)ccc1OCC(=O)OC |
| InChI | InChI=1S/C28H24F6O3S/c1-3-18-16-23(10-11-25(18)37-17-26(35)36-2)38-13-12-24(19-6-4-8-21(14-19)27(29,30)31)20-7-5-9-22(15-20)28(32,33)34/h4-12,14-16H,3,13,17H2,1-2H3 |
| InChIKey | AVHBGKUQMGHRJB-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 554.55 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[4-[3,3-bis[3-(trifluoromethyl)phenyl]prop-2-enylsulfanyl]-2-ethylphenoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[4-[3,3-bis[3-(trifluoromethyl)phenyl]prop-2-enylsulfanyl]-2-ethylphenoxy]acetate?
The IUPAC name of methyl 2-[4-[3,3-bis[3-(trifluoromethyl)phenyl]prop-2-enylsulfanyl]-2-ethylphenoxy]acetate (CID 10007839) is methyl 2-[4-[3,3-bis[3-(trifluoromethyl)phenyl]prop-2-enylsulfanyl]-2-ethylphenoxy]acetate.
What is the SMILES notation for methyl 2-[4-[3,3-bis[3-(trifluoromethyl)phenyl]prop-2-enylsulfanyl]-2-ethylphenoxy]acetate?
The canonical SMILES for methyl 2-[4-[3,3-bis[3-(trifluoromethyl)phenyl]prop-2-enylsulfanyl]-2-ethylphenoxy]acetate is CCc1cc(SCC=C(c2cccc(C(F)(F)F)c2)c2cccc(C(F)(F)F)c2)ccc1OCC(=O)OC.
What is the InChIKey of methyl 2-[4-[3,3-bis[3-(trifluoromethyl)phenyl]prop-2-enylsulfanyl]-2-ethylphenoxy]acetate?
The InChIKey is AVHBGKUQMGHRJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H24F6O3S/c1-3-18-16-23(10-11-25(18)37-17-26(35)36-2)38-13-12-24(19-6-4-8-21(14-19)27(29,30)31)20-7-5-9-22(15-20)28(32,33)34/h4-12,14-16H,3,13,17H2,1-2H3.
What are the key properties of methyl 2-[4-[3,3-bis[3-(trifluoromethyl)phenyl]prop-2-enylsulfanyl]-2-ethylphenoxy]acetate?
methyl 2-[4-[3,3-bis[3-(trifluoromethyl)phenyl]prop-2-enylsulfanyl]-2-ethylphenoxy]acetate has a molecular weight of 554.55 g/mol, XLogP of 8.06, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[4-[3,3-bis[3-(trifluoromethyl)phenyl]prop-2-enylsulfanyl]-2-ethylphenoxy]acetate is sourced from PubChem (CID 10007839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).