C27H29Br2N3O — CID 10008218
4-[3-[(4-bromophenyl)methyl]-2-methyl-4,5-dihydroimidazol-3-ium-1-yl]-2,2-diphenylbutanamide bromide (PubChem CID 10008218) has the molecular formula C27H29Br2N3O and a molecular weight of 571.36 g/mol. Its IUPAC name is 4-[3-[(4-bromophenyl)methyl]-2-methyl-4,5-dihydroimidazol-3-ium-1-yl]-2,2-diphenylbutanamide bromide.
| Compound Name | 4-[3-[(4-bromophenyl)methyl]-2-methyl-4,5-dihydroimidazol-3-ium-1-yl]-2,2-diphenylbutanamide bromide |
|---|---|
| PubChem CID | 10008218 |
| Molecular Formula | C27H29Br2N3O |
| Molecular Weight | 571.36 g/mol |
| Exact Mass | 569.07 |
| IUPAC Name | 4-[3-[(4-bromophenyl)methyl]-2-methyl-4,5-dihydroimidazol-3-ium-1-yl]-2,2-diphenylbutanamide bromide |
| SMILES | CC1=[N+](Cc2ccc(Br)cc2)CCN1CCC(C(N)=O)(c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C27H28BrN3O.BrH/c1-21-30(18-19-31(21)20-22-12-14-25(28)15-13-22)17-16-27(26(29)32,23-8-4-2-5-9-23)24-10-6-3-7-11-24;/h2-15H,16-20H2,1H3,(H-,29,32);1H |
| InChIKey | BIVYIHQSSDXREB-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 49.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|