C35H40BrP — CID 10008224
[(E)-3-(4,4-dimethyl-1,2,3,7,8,9-hexahydrobenzo[7]annulen-6-yl)but-2-enyl]-triphenylphosphanium bromide (PubChem CID 10008224) has the molecular formula C35H40BrP and a molecular weight of 571.58 g/mol. Its IUPAC name is [(E)-3-(4,4-dimethyl-1,2,3,7,8,9-hexahydrobenzo[7]annulen-6-yl)but-2-enyl]-triphenylphosphanium bromide.
| Compound Name | [(E)-3-(4,4-dimethyl-1,2,3,7,8,9-hexahydrobenzo[7]annulen-6-yl)but-2-enyl]-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 10008224 |
| Molecular Formula | C35H40BrP |
| Molecular Weight | 571.58 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | [(E)-3-(4,4-dimethyl-1,2,3,7,8,9-hexahydrobenzo[7]annulen-6-yl)but-2-enyl]-triphenylphosphanium bromide |
| SMILES | C/C(=C\C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)C1=CC2=C(CCC1)CCCC2(C)C.[Br-] |
| InChI | InChI=1S/C35H40P.BrH/c1-28(30-16-13-15-29-17-14-25-35(2,3)34(29)27-30)24-26-36(31-18-7-4-8-19-31,32-20-9-5-10-21-32)33-22-11-6-12-23-33;/h4-12,18-24,27H,13-17,25-26H2,1-3H3;1H/q+1;/p-1/b28-24+; |
| InChIKey | BDGWTCZGCDNKKG-YTGAECEWSA-M |
| XLogP | 5.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.58 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|