C37H50F2N2O — CID 10008352
4-[[4-[6,6-bis(4-fluorophenyl)hexyl]piperazin-1-yl]methyl]-2,6-ditert-butylphenol (PubChem CID 10008352) has the molecular formula C37H50F2N2O and a molecular weight of 576.82 g/mol. Its IUPAC name is 4-[[4-[6,6-bis(4-fluorophenyl)hexyl]piperazin-1-yl]methyl]-2,6-ditert-butylphenol.
| Compound Name | 4-[[4-[6,6-bis(4-fluorophenyl)hexyl]piperazin-1-yl]methyl]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 10008352 |
| Molecular Formula | C37H50F2N2O |
| Molecular Weight | 576.82 g/mol |
| Exact Mass | 576.39 |
| IUPAC Name | 4-[[4-[6,6-bis(4-fluorophenyl)hexyl]piperazin-1-yl]methyl]-2,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(CN2CCN(CCCCCC(c3ccc(F)cc3)c3ccc(F)cc3)CC2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C37H50F2N2O/c1-36(2,3)33-24-27(25-34(35(33)42)37(4,5)6)26-41-22-20-40(21-23-41)19-9-7-8-10-32(28-11-15-30(38)16-12-28)29-13-17-31(39)18-14-29/h11-18,24-25,32,42H,7-10,19-23,26H2,1-6H3 |
| InChIKey | AMMLIKZUXHUTJS-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.82 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|