C33H32N4O6 — CID 10008405
(3S)-3-[[(2S,5S,11bS)-3-oxo-2-(phenylmethoxycarbonylamino)-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indole-5-carbonyl]amino]-4-phenylbutanoic acid (PubChem CID 10008405) has the molecular formula C33H32N4O6 and a molecular weight of 580.64 g/mol. Its IUPAC name is (3S)-3-[[(2S,5S,11bS)-3-oxo-2-(phenylmethoxycarbonylamino)-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indole-5-carbonyl]amino]-4-phenylbutanoic acid.
| Compound Name | (3S)-3-[[(2S,5S,11bS)-3-oxo-2-(phenylmethoxycarbonylamino)-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indole-5-carbonyl]amino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 10008405 |
| Molecular Formula | C33H32N4O6 |
| Molecular Weight | 580.64 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | (3S)-3-[[(2S,5S,11bS)-3-oxo-2-(phenylmethoxycarbonylamino)-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indole-5-carbonyl]amino]-4-phenylbutanoic acid |
| SMILES | O=C(O)C[C@H](Cc1ccccc1)NC(=O)[C@@H]1Cc2c([nH]c3ccccc23)[C@@H]2C[C@H](NC(=O)OCc3ccccc3)C(=O)N12 |
| InChI | InChI=1S/C33H32N4O6/c38-29(39)16-22(15-20-9-3-1-4-10-20)34-31(40)28-17-24-23-13-7-8-14-25(23)35-30(24)27-18-26(32(41)37(27)28)36-33(42)43-19-21-11-5-2-6-12-21/h1-14,22,26-28,35H,15-19H2,(H,34,40)(H,36,42)(H,38,39)/t22-,26-,27-,28-/m0/s1 |
| InChIKey | PCHYMTHJLQQDLT-ACNFANBVSA-N |
| XLogP | 3.86 |
| TPSA | 140.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.64 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|