C34H34FN3O5 — CID 10008455
N-[4-[3-[(3,4-dimethoxyphenyl)methyl-methylamino]propyl]-2-methoxyphenyl]-5-fluoro-9-oxo-10H-acridine-4-carboxamide (PubChem CID 10008455) has the molecular formula C34H34FN3O5 and a molecular weight of 583.66 g/mol. Its IUPAC name is N-[4-[3-[(3,4-dimethoxyphenyl)methyl-methylamino]propyl]-2-methoxyphenyl]-5-fluoro-9-oxo-10H-acridine-4-carboxamide.
| Compound Name | N-[4-[3-[(3,4-dimethoxyphenyl)methyl-methylamino]propyl]-2-methoxyphenyl]-5-fluoro-9-oxo-10H-acridine-4-carboxamide |
|---|---|
| PubChem CID | 10008455 |
| Molecular Formula | C34H34FN3O5 |
| Molecular Weight | 583.66 g/mol |
| Exact Mass | 583.25 |
| IUPAC Name | N-[4-[3-[(3,4-dimethoxyphenyl)methyl-methylamino]propyl]-2-methoxyphenyl]-5-fluoro-9-oxo-10H-acridine-4-carboxamide |
| SMILES | COc1cc(CCCN(C)Cc2ccc(OC)c(OC)c2)ccc1NC(=O)c1cccc2c(=O)c3cccc(F)c3[nH]c12 |
| InChI | InChI=1S/C34H34FN3O5/c1-38(20-22-14-16-28(41-2)30(19-22)43-4)17-7-8-21-13-15-27(29(18-21)42-3)36-34(40)25-11-5-9-23-31(25)37-32-24(33(23)39)10-6-12-26(32)35/h5-6,9-16,18-19H,7-8,17,20H2,1-4H3,(H,36,40)(H,37,39) |
| InChIKey | BESYCJRUPXCAQN-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.66 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|