C34H44O5SSi — CID 10008618
[(2S,3S,5R,6S,11R)-5-(benzenesulfonyl)-3,11-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 10008618) has the molecular formula C34H44O5SSi and a molecular weight of 592.87 g/mol. Its IUPAC name is [(2S,3S,5R,6S,11R)-5-(benzenesulfonyl)-3,11-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(2S,3S,5R,6S,11R)-5-(benzenesulfonyl)-3,11-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 10008618 |
| Molecular Formula | C34H44O5SSi |
| Molecular Weight | 592.87 g/mol |
| Exact Mass | 592.27 |
| IUPAC Name | [(2S,3S,5R,6S,11R)-5-(benzenesulfonyl)-3,11-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | C[C@@H]1CCCO[C@]12O[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](C)C[C@H]2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C34H44O5SSi/c1-26-24-32(40(35,36)28-17-9-6-10-18-28)34(27(2)16-15-23-37-34)39-31(26)25-38-41(33(3,4)5,29-19-11-7-12-20-29)30-21-13-8-14-22-30/h6-14,17-22,26-27,31-32H,15-16,23-25H2,1-5H3/t26-,27+,31+,32+,34-/m0/s1 |
| InChIKey | BPFJNROXCOHIHQ-HCZXOXEYSA-N |
| XLogP | 5.97 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.87 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|