C35H40N4O5 — CID 10008665
(4-nitrophenyl)methyl N-[1-[[(2S,3aS,4S,5S)-2,4-diphenyl-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-5-yl]methyl]piperidin-4-yl]-N-prop-2-enylcarbamate (PubChem CID 10008665) has the molecular formula C35H40N4O5 and a molecular weight of 596.73 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-[1-[[(2S,3aS,4S,5S)-2,4-diphenyl-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-5-yl]methyl]piperidin-4-yl]-N-prop-2-enylcarbamate.
| Compound Name | (4-nitrophenyl)methyl N-[1-[[(2S,3aS,4S,5S)-2,4-diphenyl-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-5-yl]methyl]piperidin-4-yl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 10008665 |
| Molecular Formula | C35H40N4O5 |
| Molecular Weight | 596.73 g/mol |
| Exact Mass | 596.30 |
| IUPAC Name | (4-nitrophenyl)methyl N-[1-[[(2S,3aS,4S,5S)-2,4-diphenyl-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-5-yl]methyl]piperidin-4-yl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C(=O)OCc1ccc([N+](=O)[O-])cc1)C1CCN(C[C@H]2CN3O[C@H](c4ccccc4)C[C@H]3[C@@H]2c2ccccc2)CC1 |
| InChI | InChI=1S/C35H40N4O5/c1-2-19-37(35(40)43-25-26-13-15-31(16-14-26)39(41)42)30-17-20-36(21-18-30)23-29-24-38-32(34(29)28-11-7-4-8-12-28)22-33(44-38)27-9-5-3-6-10-27/h2-16,29-30,32-34H,1,17-25H2/t29-,32-,33-,34+/m0/s1 |
| InChIKey | PTAWGYLKONHXLB-TUONYQKMSA-N |
| XLogP | 6.34 |
| TPSA | 88.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.73 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|