C28H28ClF4N3O5 — CID 10008682
3-[[(2S)-2-(7-chloro-1-oxoisoquinolin-2-yl)butanoyl]amino]-N,N-diethyl-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanamide (PubChem CID 10008682) has the molecular formula C28H28ClF4N3O5 and a molecular weight of 597.99 g/mol. Its IUPAC name is 3-[[(2S)-2-(7-chloro-1-oxoisoquinolin-2-yl)butanoyl]amino]-N,N-diethyl-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanamide.
| Compound Name | 3-[[(2S)-2-(7-chloro-1-oxoisoquinolin-2-yl)butanoyl]amino]-N,N-diethyl-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanamide |
|---|---|
| PubChem CID | 10008682 |
| Molecular Formula | C28H28ClF4N3O5 |
| Molecular Weight | 597.99 g/mol |
| Exact Mass | 597.17 |
| IUPAC Name | 3-[[(2S)-2-(7-chloro-1-oxoisoquinolin-2-yl)butanoyl]amino]-N,N-diethyl-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanamide |
| SMILES | CC[C@@H](C(=O)NC(CC(=O)N(CC)CC)C(=O)COc1c(F)c(F)cc(F)c1F)n1ccc2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C28H28ClF4N3O5/c1-4-21(36-10-9-15-7-8-16(29)11-17(15)28(36)40)27(39)34-20(13-23(38)35(5-2)6-3)22(37)14-41-26-24(32)18(30)12-19(31)25(26)33/h7-12,20-21H,4-6,13-14H2,1-3H3,(H,34,39)/t20?,21-/m0/s1 |
| InChIKey | DWONGUWAYBYSOI-LBAQZLPGSA-N |
| XLogP | 4.55 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.99 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|