C38H48N6O2 — CID 10009042
3-[4-[8-[[4-(5-carbamoyl-1H-indol-3-yl)cyclohex-3-en-1-yl]amino]octylamino]cyclohexen-1-yl]-1H-indole-5-carboxamide (PubChem CID 10009042) has the molecular formula C38H48N6O2 and a molecular weight of 620.84 g/mol. Its IUPAC name is 3-[4-[8-[[4-(5-carbamoyl-1H-indol-3-yl)cyclohex-3-en-1-yl]amino]octylamino]cyclohexen-1-yl]-1H-indole-5-carboxamide.
| Compound Name | 3-[4-[8-[[4-(5-carbamoyl-1H-indol-3-yl)cyclohex-3-en-1-yl]amino]octylamino]cyclohexen-1-yl]-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 10009042 |
| Molecular Formula | C38H48N6O2 |
| Molecular Weight | 620.84 g/mol |
| Exact Mass | 620.38 |
| IUPAC Name | 3-[4-[8-[[4-(5-carbamoyl-1H-indol-3-yl)cyclohex-3-en-1-yl]amino]octylamino]cyclohexen-1-yl]-1H-indole-5-carboxamide |
| SMILES | NC(=O)c1ccc2[nH]cc(C3=CCC(NCCCCCCCCNC4CC=C(c5c[nH]c6ccc(C(N)=O)cc56)CC4)CC3)c2c1 |
| InChI | InChI=1S/C38H48N6O2/c39-37(45)27-11-17-35-31(21-27)33(23-43-35)25-7-13-29(14-8-25)41-19-5-3-1-2-4-6-20-42-30-15-9-26(10-16-30)34-24-44-36-18-12-28(38(40)46)22-32(34)36/h7,9,11-12,17-18,21-24,29-30,41-44H,1-6,8,10,13-16,19-20H2,(H2,39,45)(H2,40,46) |
| InChIKey | QXXXZTFUFKESQI-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 141.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.84 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|