C32H42N4O7S — CID 10009134
1-[[4-(dimethylamino)-4-phenylcyclohexyl]methyl]-3-[2-(1H-indol-3-yl)ethyl]thiourea;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 10009134) has the molecular formula C32H42N4O7S and a molecular weight of 626.78 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)-4-phenylcyclohexyl]methyl]-3-[2-(1H-indol-3-yl)ethyl]thiourea;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 1-[[4-(dimethylamino)-4-phenylcyclohexyl]methyl]-3-[2-(1H-indol-3-yl)ethyl]thiourea;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 10009134 |
| Molecular Formula | C32H42N4O7S |
| Molecular Weight | 626.78 g/mol |
| Exact Mass | 626.28 |
| IUPAC Name | 1-[[4-(dimethylamino)-4-phenylcyclohexyl]methyl]-3-[2-(1H-indol-3-yl)ethyl]thiourea;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CN(C)C1(c2ccccc2)CCC(CNC(=S)NCCc2c[nH]c3ccccc23)CC1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C26H34N4S.C6H8O7/c1-30(2)26(22-8-4-3-5-9-22)15-12-20(13-16-26)18-29-25(31)27-17-14-21-19-28-24-11-7-6-10-23(21)24;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-11,19-20,28H,12-18H2,1-2H3,(H2,27,29,31);13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | RWOZKPYHXQDSMG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 175.22 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.78 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|