About 2-[2-[(3,4-didecoxyphenyl)carbamoyl]phenyl]benzoic acid
2-[2-[(3,4-didecoxyphenyl)carbamoyl]phenyl]benzoic acid (PubChem CID 10009179) has the molecular formula C40H55NO5
and a molecular weight of 629.88 g/mol. Its IUPAC name is 2-[2-[(3,4-didecoxyphenyl)carbamoyl]phenyl]benzoic acid.
Molecular Properties
| Compound Name | 2-[2-[(3,4-didecoxyphenyl)carbamoyl]phenyl]benzoic acid |
| PubChem CID | 10009179 |
| Molecular Formula | C40H55NO5 |
| Molecular Weight | 629.88 g/mol |
| Exact Mass | 629.41 |
| IUPAC Name | 2-[2-[(3,4-didecoxyphenyl)carbamoyl]phenyl]benzoic acid |
| SMILES | CCCCCCCCCCOc1ccc(NC(=O)c2ccccc2-c2ccccc2C(=O)O)cc1OCCCCCCCCCC |
| InChI | InChI=1S/C40H55NO5/c1-3-5-7-9-11-13-15-21-29-45-37-28-27-32(31-38(37)46-30-22-16-14-12-10-8-6-4-2)41-39(42)35-25-19-17-23-33(35)34-24-18-20-26-36(34)40(43)44/h17-20,23-28,31H,3-16,21-22,29-30H2,1-2H3,(H,41,42)(H,43,44) |
| InChIKey | SNTYHLUZMABFSP-UHFFFAOYSA-N |
| XLogP | 11.34 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 629.88 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(3,4-didecoxyphenyl)carbamoyl]phenyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(3,4-didecoxyphenyl)carbamoyl]phenyl]benzoic acid?
The IUPAC name of 2-[2-[(3,4-didecoxyphenyl)carbamoyl]phenyl]benzoic acid (CID 10009179) is 2-[2-[(3,4-didecoxyphenyl)carbamoyl]phenyl]benzoic acid.
What is the SMILES notation for 2-[2-[(3,4-didecoxyphenyl)carbamoyl]phenyl]benzoic acid?
The canonical SMILES for 2-[2-[(3,4-didecoxyphenyl)carbamoyl]phenyl]benzoic acid is CCCCCCCCCCOc1ccc(NC(=O)c2ccccc2-c2ccccc2C(=O)O)cc1OCCCCCCCCCC.
What is the InChIKey of 2-[2-[(3,4-didecoxyphenyl)carbamoyl]phenyl]benzoic acid?
The InChIKey is SNTYHLUZMABFSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H55NO5/c1-3-5-7-9-11-13-15-21-29-45-37-28-27-32(31-38(37)46-30-22-16-14-12-10-8-6-4-2)41-39(42)35-25-19-17-23-33(35)34-24-18-20-26-36(34)40(43)44/h17-20,23-28,31H,3-16,21-22,29-30H2,1-2H3,(H,41,42)(H,43,44).
What are the key properties of 2-[2-[(3,4-didecoxyphenyl)carbamoyl]phenyl]benzoic acid?
2-[2-[(3,4-didecoxyphenyl)carbamoyl]phenyl]benzoic acid has a molecular weight of 629.88 g/mol, XLogP of 11.34, 24 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(3,4-didecoxyphenyl)carbamoyl]phenyl]benzoic acid is sourced from PubChem (CID 10009179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).