C37H47FN4O5 — CID 10009410
(2R)-N-[(2R,4R,5R)-5-[[2-(4-fluoro-2,6-dimethylphenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanamide (PubChem CID 10009410) has the molecular formula C37H47FN4O5 and a molecular weight of 646.80 g/mol. Its IUPAC name is (2R)-N-[(2R,4R,5R)-5-[[2-(4-fluoro-2,6-dimethylphenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanamide.
| Compound Name | (2R)-N-[(2R,4R,5R)-5-[[2-(4-fluoro-2,6-dimethylphenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanamide |
|---|---|
| PubChem CID | 10009410 |
| Molecular Formula | C37H47FN4O5 |
| Molecular Weight | 646.80 g/mol |
| Exact Mass | 646.35 |
| IUPAC Name | (2R)-N-[(2R,4R,5R)-5-[[2-(4-fluoro-2,6-dimethylphenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanamide |
| SMILES | Cc1cc(F)cc(C)c1OCC(=O)N[C@H](Cc1ccccc1)[C@H](O)C[C@@H](Cc1ccccc1)NC(=O)[C@@H](C(C)C)N1CCCNC1=O |
| InChI | InChI=1S/C37H47FN4O5/c1-24(2)34(42-17-11-16-39-37(42)46)36(45)40-30(20-27-12-7-5-8-13-27)22-32(43)31(21-28-14-9-6-10-15-28)41-33(44)23-47-35-25(3)18-29(38)19-26(35)4/h5-10,12-15,18-19,24,30-32,34,43H,11,16-17,20-23H2,1-4H3,(H,39,46)(H,40,45)(H,41,44)/t30-,31-,32-,34-/m1/s1 |
| InChIKey | BDBQNBWIQSASDU-UKNNOAMWSA-N |
| XLogP | 4.47 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.80 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |