C31H35F3O8SSi — CID 10009482
[(2R,4aR,6S,7R,8S,8aR)-7-[tert-butyl(diphenyl)silyl]oxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] trifluoromethanesulfonate (PubChem CID 10009482) has the molecular formula C31H35F3O8SSi and a molecular weight of 652.76 g/mol. Its IUPAC name is [(2R,4aR,6S,7R,8S,8aR)-7-[tert-butyl(diphenyl)silyl]oxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] trifluoromethanesulfonate.
| Compound Name | [(2R,4aR,6S,7R,8S,8aR)-7-[tert-butyl(diphenyl)silyl]oxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10009482 |
| Molecular Formula | C31H35F3O8SSi |
| Molecular Weight | 652.76 g/mol |
| Exact Mass | 652.18 |
| IUPAC Name | [(2R,4aR,6S,7R,8S,8aR)-7-[tert-butyl(diphenyl)silyl]oxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] trifluoromethanesulfonate |
| SMILES | CO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](OS(=O)(=O)C(F)(F)F)[C@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H35F3O8SSi/c1-30(2,3)44(22-16-10-6-11-17-22,23-18-12-7-13-19-23)42-27-26(41-43(35,36)31(32,33)34)25-24(39-29(27)37-4)20-38-28(40-25)21-14-8-5-9-15-21/h5-19,24-29H,20H2,1-4H3/t24-,25-,26+,27-,28-,29+/m1/s1 |
| InChIKey | QMGWJAZSILOHAD-MRMYXZNTSA-N |
| XLogP | 4.65 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.76 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|