C34H66N4O+2 — CID 10009494
3-aminopropyl-[4-[dimethyl-[3-[[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoyl]amino]propyl]azaniumyl]butyl]-dimethylazanium (PubChem CID 10009494) has the molecular formula C34H66N4O+2 and a molecular weight of 546.93 g/mol. Its IUPAC name is 3-aminopropyl-[4-[dimethyl-[3-[[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoyl]amino]propyl]azaniumyl]butyl]-dimethylazanium.
| Compound Name | 3-aminopropyl-[4-[dimethyl-[3-[[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoyl]amino]propyl]azaniumyl]butyl]-dimethylazanium |
|---|---|
| PubChem CID | 10009494 |
| Molecular Formula | C34H66N4O+2 |
| Molecular Weight | 546.93 g/mol |
| Exact Mass | 546.52 |
| IUPAC Name | 3-aminopropyl-[4-[dimethyl-[3-[[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoyl]amino]propyl]azaniumyl]butyl]-dimethylazanium |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/C(=O)NCCC[N+](C)(C)CCCC[N+](C)(C)CCCN |
| InChI | InChI=1S/C34H65N4O/c1-30(2)17-12-18-31(3)19-13-20-32(4)21-14-22-33(5)29-34(39)36-24-16-28-38(8,9)26-11-10-25-37(6,7)27-15-23-35/h17,19,21,29H,10-16,18,20,22-28,35H2,1-9H3/q+1/p+1/b31-19+,32-21+,33-29+ |
| InChIKey | CENDAKYLVBQITO-OFZQNWGUSA-O |
| XLogP | 6.92 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.93 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|