C40H54N4O4 — CID 10009514
2-[3-[cyclohexyl-[6-[cyclohexyl-[3-(1,3-dioxoisoindol-2-yl)propyl]amino]hexyl]amino]propyl]isoindole-1,3-dione (PubChem CID 10009514) has the molecular formula C40H54N4O4 and a molecular weight of 654.90 g/mol. Its IUPAC name is 2-[3-[cyclohexyl-[6-[cyclohexyl-[3-(1,3-dioxoisoindol-2-yl)propyl]amino]hexyl]amino]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[cyclohexyl-[6-[cyclohexyl-[3-(1,3-dioxoisoindol-2-yl)propyl]amino]hexyl]amino]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10009514 |
| Molecular Formula | C40H54N4O4 |
| Molecular Weight | 654.90 g/mol |
| Exact Mass | 654.41 |
| IUPAC Name | 2-[3-[cyclohexyl-[6-[cyclohexyl-[3-(1,3-dioxoisoindol-2-yl)propyl]amino]hexyl]amino]propyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCN(CCCCCCN(CCCN1C(=O)c2ccccc2C1=O)C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C40H54N4O4/c45-37-33-21-9-10-22-34(33)38(46)43(37)29-15-27-41(31-17-5-3-6-18-31)25-13-1-2-14-26-42(32-19-7-4-8-20-32)28-16-30-44-39(47)35-23-11-12-24-36(35)40(44)48/h9-12,21-24,31-32H,1-8,13-20,25-30H2 |
| InChIKey | IPFHFZGETVWVEB-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.90 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|