C31H38ClF6N5O2 — CID 10009576
methyl 5-[[3-[[[3,5-bis(trifluoromethyl)phenyl]methyl-(1-methyl-1,2,4-triazol-3-yl)amino]methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]-ethylamino]pentanoate;hydrochloride (PubChem CID 10009576) has the molecular formula C31H38ClF6N5O2 and a molecular weight of 662.12 g/mol. Its IUPAC name is methyl 5-[[3-[[[3,5-bis(trifluoromethyl)phenyl]methyl-(1-methyl-1,2,4-triazol-3-yl)amino]methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]-ethylamino]pentanoate;hydrochloride.
| Compound Name | methyl 5-[[3-[[[3,5-bis(trifluoromethyl)phenyl]methyl-(1-methyl-1,2,4-triazol-3-yl)amino]methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]-ethylamino]pentanoate;hydrochloride |
|---|---|
| PubChem CID | 10009576 |
| Molecular Formula | C31H38ClF6N5O2 |
| Molecular Weight | 662.12 g/mol |
| Exact Mass | 661.26 |
| IUPAC Name | methyl 5-[[3-[[[3,5-bis(trifluoromethyl)phenyl]methyl-(1-methyl-1,2,4-triazol-3-yl)amino]methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]-ethylamino]pentanoate;hydrochloride |
| SMILES | CCN(CCCCC(=O)OC)c1cc2c(cc1CN(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ncn(C)n1)CCCC2.Cl |
| InChI | InChI=1S/C31H37F6N5O2.ClH/c1-4-41(12-8-7-11-28(43)44-3)27-16-23-10-6-5-9-22(23)15-24(27)19-42(29-38-20-40(2)39-29)18-21-13-25(30(32,33)34)17-26(14-21)31(35,36)37;/h13-17,20H,4-12,18-19H2,1-3H3;1H |
| InChIKey | BSPSKBVZYZGJMY-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.12 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|