C31H37F6N5O2 — CID 10009577
methyl 5-[[3-[[[3,5-bis(trifluoromethyl)phenyl]methyl-(1-methyl-1,2,4-triazol-3-yl)amino]methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]-ethylamino]pentanoate (PubChem CID 10009577) has the molecular formula C31H37F6N5O2 and a molecular weight of 625.66 g/mol. Its IUPAC name is methyl 5-[[3-[[[3,5-bis(trifluoromethyl)phenyl]methyl-(1-methyl-1,2,4-triazol-3-yl)amino]methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]-ethylamino]pentanoate.
| Compound Name | methyl 5-[[3-[[[3,5-bis(trifluoromethyl)phenyl]methyl-(1-methyl-1,2,4-triazol-3-yl)amino]methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]-ethylamino]pentanoate |
|---|---|
| PubChem CID | 10009577 |
| Molecular Formula | C31H37F6N5O2 |
| Molecular Weight | 625.66 g/mol |
| Exact Mass | 625.29 |
| IUPAC Name | methyl 5-[[3-[[[3,5-bis(trifluoromethyl)phenyl]methyl-(1-methyl-1,2,4-triazol-3-yl)amino]methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]-ethylamino]pentanoate |
| SMILES | CCN(CCCCC(=O)OC)c1cc2c(cc1CN(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ncn(C)n1)CCCC2 |
| InChI | InChI=1S/C31H37F6N5O2/c1-4-41(12-8-7-11-28(43)44-3)27-16-23-10-6-5-9-22(23)15-24(27)19-42(29-38-20-40(2)39-29)18-21-13-25(30(32,33)34)17-26(14-21)31(35,36)37/h13-17,20H,4-12,18-19H2,1-3H3 |
| InChIKey | YVYFDHNQSQVRLT-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.66 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|